methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate

C30H24N2O3 — CID 11612322

IUPACmethyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate
SMILESCOC(=O)c1ccccc1OCc1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1
InChIInChI=1S/C30H24N2O3/c1-34-30(33)25-19-11-12-20-27(25)35-21-26-28(22-13-5-2-6-14-22)29(23-15-7-3-8-16-23)31-32(26)24-17-9-4-10-18-24/h2-20H,21H2,1H3
InChIKeyVQIYYRWKVWMKQA-UHFFFAOYSA-N
MW460.53 g/mol
LogP6.57
Rot. Bonds7

About methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate

methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate (PubChem CID 11612322) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate
PubChem CID11612322
Molecular FormulaC30H24N2O3
Molecular Weight460.53 g/mol
Exact Mass460.18
IUPAC Namemethyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate
SMILESCOC(=O)c1ccccc1OCc1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1
InChIInChI=1S/C30H24N2O3/c1-34-30(33)25-19-11-12-20-27(25)35-21-26-28(22-13-5-2-6-14-22)29(23-15-7-3-8-16-23)31-32(26)24-17-9-4-10-18-24/h2-20H,21H2,1H3
InChIKeyVQIYYRWKVWMKQA-UHFFFAOYSA-N
XLogP6.57
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms35
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500460.53
LogP ≤ 56.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate?
The IUPAC name of methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate (CID 11612322) is methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate.
What is the SMILES notation for methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate?
The canonical SMILES for methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate is COC(=O)c1ccccc1OCc1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate?
The InChIKey is VQIYYRWKVWMKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N2O3/c1-34-30(33)25-19-11-12-20-27(25)35-21-26-28(22-13-5-2-6-14-22)29(23-15-7-3-8-16-23)31-32(26)24-17-9-4-10-18-24/h2-20H,21H2,1H3.
What are the key properties of methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate?
methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate has a molecular weight of 460.53 g/mol, XLogP of 6.57, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,4,5-triphenylpyrazol-3-yl)methoxy]benzoate is sourced from PubChem (CID 11612322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).