C21H24F3N5O2S — CID 11612447
N-(3-cyclopropylpropyl)-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11612447) has the molecular formula C21H24F3N5O2S and a molecular weight of 467.52 g/mol. Its IUPAC name is N-(3-cyclopropylpropyl)-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(3-cyclopropylpropyl)-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11612447 |
| Molecular Formula | C21H24F3N5O2S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-(3-cyclopropylpropyl)-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCCC1CC1)c1nnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C21H24F3N5O2S/c22-21(23,24)16-6-2-1-5-15(16)19(31)28-10-12-29(13-11-28)20-27-26-18(32-20)17(30)25-9-3-4-14-7-8-14/h1-2,5-6,14H,3-4,7-13H2,(H,25,30) |
| InChIKey | XBYDSPFXPRTEIY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|