C21H26F3N5O2S — CID 11612494
N-hexyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11612494) has the molecular formula C21H26F3N5O2S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-hexyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-hexyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11612494 |
| Molecular Formula | C21H26F3N5O2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-hexyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1nnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C21H26F3N5O2S/c1-2-3-4-7-10-25-17(30)18-26-27-20(32-18)29-13-11-28(12-14-29)19(31)15-8-5-6-9-16(15)21(22,23)24/h5-6,8-9H,2-4,7,10-14H2,1H3,(H,25,30) |
| InChIKey | XEZOVIDVUOSZTF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|