About 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione
3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione (PubChem CID 11612570) has the molecular formula C23H27N5O4
and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione.
Molecular Properties
| Compound Name | 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione |
| PubChem CID | 11612570 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione |
| SMILES | CC(C)=CCn1c(O[C@H]2CCNC2)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C23H27N5O4/c1-15(2)10-12-27-19-20(25-22(27)32-17-9-11-24-13-17)26(3)23(31)28(21(19)30)14-18(29)16-7-5-4-6-8-16/h4-8,10,17,24H,9,11-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | DCHXUYKURCFYFH-KRWDZBQOSA-N |
| XLogP | 1.49 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione?
The IUPAC name of 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione (CID 11612570) is 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione.
What is the SMILES notation for 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione?
The canonical SMILES for 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione is CC(C)=CCn1c(O[C@H]2CCNC2)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C.
What is the InChIKey of 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione?
The InChIKey is DCHXUYKURCFYFH-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H27N5O4/c1-15(2)10-12-27-19-20(25-22(27)32-17-9-11-24-13-17)26(3)23(31)28(21(19)30)14-18(29)16-7-5-4-6-8-16/h4-8,10,17,24H,9,11-14H2,1-3H3/t17-/m0/s1.
What are the key properties of 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione?
3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione has a molecular weight of 437.50 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-(3-methylbut-2-enyl)-1-phenacyl-8-[(3S)-pyrrolidin-3-yl]oxypurine-2,6-dione is sourced from PubChem (CID 11612570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).