C17H5F10NO2S — CID 11612636
(E)-3-(2,3,4,5,6-pentafluorophenyl)-N-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfinylprop-2-enamide (PubChem CID 11612636) has the molecular formula C17H5F10NO2S and a molecular weight of 477.28 g/mol. Its IUPAC name is (E)-3-(2,3,4,5,6-pentafluorophenyl)-N-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfinylprop-2-enamide.
| Compound Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-N-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfinylprop-2-enamide |
|---|---|
| PubChem CID | 11612636 |
| Molecular Formula | C17H5F10NO2S |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-N-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]sulfinylprop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)c(F)c(F)c(F)c1F)NS(=O)/C=C/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H5F10NO2S/c18-8-5(9(19)13(23)16(26)12(8)22)1-2-7(29)28-31(30)4-3-6-10(20)14(24)17(27)15(25)11(6)21/h1-4H,(H,28,29)/b2-1+,4-3+ |
| InChIKey | CVZPJTDGGUOIQN-MVJNYCIBSA-N |
| XLogP | 4.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|