About N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide
N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide (PubChem CID 11612826) has the molecular formula C18H18Br2ClN3O
and a molecular weight of 487.62 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide |
| PubChem CID | 11612826 |
| Molecular Formula | C18H18Br2ClN3O |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 484.95 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCN(Cc2ccc(Br)c(Br)c2)CC1 |
| InChI | InChI=1S/C18H18Br2ClN3O/c19-16-5-4-13(10-17(16)20)12-23-6-8-24(9-7-23)18(25)22-15-3-1-2-14(21)11-15/h1-5,10-11H,6-9,12H2,(H,22,25) |
| InChIKey | QTKUCHXTYSOIAW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide?
The IUPAC name of N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide (CID 11612826) is N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide.
What is the SMILES notation for N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide?
The canonical SMILES for N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide is O=C(Nc1cccc(Cl)c1)N1CCN(Cc2ccc(Br)c(Br)c2)CC1.
What is the InChIKey of N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide?
The InChIKey is QTKUCHXTYSOIAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Br2ClN3O/c19-16-5-4-13(10-17(16)20)12-23-6-8-24(9-7-23)18(25)22-15-3-1-2-14(21)11-15/h1-5,10-11H,6-9,12H2,(H,22,25).
What are the key properties of N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide?
N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide has a molecular weight of 487.62 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-4-[(3,4-dibromophenyl)methyl]piperazine-1-carboxamide is sourced from PubChem (CID 11612826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).