C28H56O4Si2 — CID 11613202
[(1S,5S)-5-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]cyclopent-2-en-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11613202) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is [(1S,5S)-5-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]cyclopent-2-en-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,5S)-5-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]cyclopent-2-en-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11613202 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | [(1S,5S)-5-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]cyclopent-2-en-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1C=CC[C@@H]1[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-26(2,3)25(29)30-21-22-17-16-18-23(22)24(32-34(12,13)28(7,8)9)19-14-15-20-31-33(10,11)27(4,5)6/h16-17,22-24H,14-15,18-21H2,1-13H3/t22-,23+,24+/m1/s1 |
| InChIKey | SHMARUZZDLRLPL-SGNDLWITSA-N |
| XLogP | 8.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|