C30H27F3N2O3 — CID 11613307
2-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 11613307) has the molecular formula C30H27F3N2O3 and a molecular weight of 520.55 g/mol. Its IUPAC name is 2-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 11613307 |
| Molecular Formula | C30H27F3N2O3 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CC(C(=O)N(Cc1ccccc1)Cc1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C30H27F3N2O3/c31-30(32,33)23-10-6-9-21(15-23)18-34(17-20-7-2-1-3-8-20)29(38)22-13-14-27-25(16-22)24-11-4-5-12-26(24)35(27)19-28(36)37/h1-12,15,22H,13-14,16-19H2,(H,36,37) |
| InChIKey | UDDXIMBXSNAVHL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|