C22H22Cl2N6O3S — CID 11613319
5-[4-(2,5-dichlorophenoxy)anilino]-3-oxo-N'-[2-(3-oxopiperazin-1-yl)ethyl]-1,2-thiazole-4-carboximidamide (PubChem CID 11613319) has the molecular formula C22H22Cl2N6O3S and a molecular weight of 521.43 g/mol. Its IUPAC name is 5-[4-(2,5-dichlorophenoxy)anilino]-3-oxo-N'-[2-(3-oxopiperazin-1-yl)ethyl]-1,2-thiazole-4-carboximidamide.
| Compound Name | 5-[4-(2,5-dichlorophenoxy)anilino]-3-oxo-N'-[2-(3-oxopiperazin-1-yl)ethyl]-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 11613319 |
| Molecular Formula | C22H22Cl2N6O3S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 5-[4-(2,5-dichlorophenoxy)anilino]-3-oxo-N'-[2-(3-oxopiperazin-1-yl)ethyl]-1,2-thiazole-4-carboximidamide |
| SMILES | N/C(=N\CCN1CCNC(=O)C1)c1c(Nc2ccc(Oc3cc(Cl)ccc3Cl)cc2)s[nH]c1=O |
| InChI | InChI=1S/C22H22Cl2N6O3S/c23-13-1-6-16(24)17(11-13)33-15-4-2-14(3-5-15)28-22-19(21(32)29-34-22)20(25)27-8-10-30-9-7-26-18(31)12-30/h1-6,11,28H,7-10,12H2,(H2,25,27)(H,26,31)(H,29,32) |
| InChIKey | RCKLEHXPUPKIQF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|