C33H25N3O2S — CID 11613407
N-(3-methoxyphenyl)-2-[5-(2-phenylethynyl)thiophen-2-yl]-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine (PubChem CID 11613407) has the molecular formula C33H25N3O2S and a molecular weight of 527.65 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[5-(2-phenylethynyl)thiophen-2-yl]-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-(3-methoxyphenyl)-2-[5-(2-phenylethynyl)thiophen-2-yl]-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 11613407 |
| Molecular Formula | C33H25N3O2S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[5-(2-phenylethynyl)thiophen-2-yl]-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1cccc(Nc2c(-c3ccc(C#Cc4ccccc4)s3)nc3c(OCc4ccccc4)cccn23)c1 |
| InChI | InChI=1S/C33H25N3O2S/c1-37-27-15-8-14-26(22-27)34-33-31(30-20-19-28(39-30)18-17-24-10-4-2-5-11-24)35-32-29(16-9-21-36(32)33)38-23-25-12-6-3-7-13-25/h2-16,19-22,34H,23H2,1H3 |
| InChIKey | SDAUPBCNPSJRSH-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|