C27H32N6O6 — CID 11613505
(2R,3R,4S,5R)-2-[6-amino-8-[[3-(4-hydroxybutoxy)-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11613505) has the molecular formula C27H32N6O6 and a molecular weight of 536.59 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[[3-(4-hydroxybutoxy)-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[[3-(4-hydroxybutoxy)-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11613505 |
| Molecular Formula | C27H32N6O6 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[[3-(4-hydroxybutoxy)-4-phenylphenyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(NCc1ccc(-c3ccccc3)c(OCCCCO)c1)n2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32N6O6/c28-24-21-25(31-15-30-24)33(26-23(37)22(36)20(14-35)39-26)27(32-21)29-13-16-8-9-18(17-6-2-1-3-7-17)19(12-16)38-11-5-4-10-34/h1-3,6-9,12,15,20,22-23,26,34-37H,4-5,10-11,13-14H2,(H,29,32)(H2,28,30,31)/t20-,22-,23-,26-/m1/s1 |
| InChIKey | XMZYIJLWLZIWIH-HUBRGWSESA-N |
| XLogP | 1.45 |
| TPSA | 181.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|