C30H44N4O3S — CID 11613574
(2S)-N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazol-2-yl)hex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide (PubChem CID 11613574) has the molecular formula C30H44N4O3S and a molecular weight of 540.77 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazol-2-yl)hex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide.
| Compound Name | (2S)-N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazol-2-yl)hex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 11613574 |
| Molecular Formula | C30H44N4O3S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (2S)-N-[(E,3S)-2,5-dimethyl-6-oxo-6-(1,3-thiazol-2-yl)hex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)c1nccs1)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H44N4O3S/c1-19(2)22(18-20(3)23(35)27-32-16-17-38-27)34(10)28(37)25(29(4,5)6)33-26(36)24(31-9)30(7,8)21-14-12-11-13-15-21/h11-19,22,24-25,31H,1-10H3,(H,33,36)/b20-18+/t22-,24-,25-/m1/s1 |
| InChIKey | WYISQCKXGKXPAA-WMBTUWJCSA-N |
| XLogP | 4.85 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|