C20H21ClF5N3O5S — CID 11613633
N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 11613633) has the molecular formula C20H21ClF5N3O5S and a molecular weight of 545.91 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11613633 |
| Molecular Formula | C20H21ClF5N3O5S |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C20H20F5N3O5S.ClH/c21-19(22,20(23,24)25)6-5-14-11-27-16(12-26-14)13-1-3-15(4-2-13)34(31,32)18(17(29)28-30)7-9-33-10-8-18;/h1-4,11-12,30H,5-10H2,(H,28,29);1H |
| InChIKey | JJKSOVJEHXDQRQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|