About bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+)
bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) (PubChem CID 11614081) has the molecular formula C8H16O6P2PtS4
and a molecular weight of 593.50 g/mol. Its IUPAC name is bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+).
Molecular Properties
| Compound Name | bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) |
| PubChem CID | 11614081 |
| Molecular Formula | C8H16O6P2PtS4 |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 592.90 |
| IUPAC Name | bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) |
| SMILES | COCC1COP(=S)([S-])O1.COCC1COP(=S)([S-])O1.[Pt+2] |
| InChI | InChI=1S/2C4H9O3PS2.Pt/c2*1-5-2-4-3-6-8(9,10)7-4;/h2*4H,2-3H2,1H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | XIXPJDNJGXQTOD-UHFFFAOYSA-L |
| XLogP | 1.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+)?
The IUPAC name of bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) (CID 11614081) is bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+).
What is the SMILES notation for bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+)?
The canonical SMILES for bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) is COCC1COP(=S)([S-])O1.COCC1COP(=S)([S-])O1.[Pt+2].
What is the InChIKey of bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+)?
The InChIKey is XIXPJDNJGXQTOD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H9O3PS2.Pt/c2*1-5-2-4-3-6-8(9,10)7-4;/h2*4H,2-3H2,1H3,(H,9,10);/q;;+2/p-2.
What are the key properties of bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+)?
bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) has a molecular weight of 593.50 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-(methoxymethyl)-2-sulfanylidene-2-sulfido-1,3,2λ5-dioxaphospholane);platinum(2+) is sourced from PubChem (CID 11614081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).