About CID 11614124
CID 11614124 (PubChem CID 11614124) has the molecular formula C27H23NOP
and a molecular weight of 408.46 g/mol.
Molecular Properties
| Compound Name | CID 11614124 |
| PubChem CID | 11614124 |
| Molecular Formula | C27H23NOP |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][C](C2=N[C@@H](Cc3ccccc3)CO2)[C](P(c2ccccc2)c2ccccc2)[CH]1 |
| InChI | InChI=1S/C27H23NOP/c1-4-11-21(12-5-1)19-22-20-29-27(28-22)25-17-10-18-26(25)30(23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-18,22H,19-20H2/t22-/m0/s1 |
| InChIKey | RQMXOFDBEFEZPS-QFIPXVFZSA-N |
| XLogP | 4.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11614124 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11614124?
The IUPAC name of CID 11614124 (CID 11614124) is not available.
What is the SMILES notation for CID 11614124?
The canonical SMILES for CID 11614124 is [CH]1[CH][C](C2=N[C@@H](Cc3ccccc3)CO2)[C](P(c2ccccc2)c2ccccc2)[CH]1.
What is the InChIKey of CID 11614124?
The InChIKey is RQMXOFDBEFEZPS-QFIPXVFZSA-N. The full InChI is InChI=1S/C27H23NOP/c1-4-11-21(12-5-1)19-22-20-29-27(28-22)25-17-10-18-26(25)30(23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-18,22H,19-20H2/t22-/m0/s1.
What are the key properties of CID 11614124?
CID 11614124 has a molecular weight of 408.46 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11614124 is sourced from PubChem (CID 11614124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).