C30H41NO12 — CID 11614177
2-[2-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethylamino]ethoxy]ethyl 3,4,5-trimethoxybenzoate (PubChem CID 11614177) has the molecular formula C30H41NO12 and a molecular weight of 607.65 g/mol. Its IUPAC name is 2-[2-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethylamino]ethoxy]ethyl 3,4,5-trimethoxybenzoate.
| Compound Name | 2-[2-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethylamino]ethoxy]ethyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11614177 |
| Molecular Formula | C30H41NO12 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | 2-[2-[2-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethoxy]ethylamino]ethoxy]ethyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCOCCNCCOCCOC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H41NO12/c1-34-23-17-21(18-24(35-2)28(23)38-5)7-8-27(32)42-15-13-40-11-9-31-10-12-41-14-16-43-30(33)22-19-25(36-3)29(39-6)26(20-22)37-4/h7-8,17-20,31H,9-16H2,1-6H3/b8-7+ |
| InChIKey | FGMOXEXEGPUTDD-BQYQJAHWSA-N |
| XLogP | 2.77 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|