About 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane
2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane (PubChem CID 11614572) has the molecular formula C33H32Cl2N5PRu
and a molecular weight of 701.60 g/mol. Its IUPAC name is 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane.
Molecular Properties
| Compound Name | 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane |
| PubChem CID | 11614572 |
| Molecular Formula | C33H32Cl2N5PRu |
| Molecular Weight | 701.60 g/mol |
| Exact Mass | 701.08 |
| IUPAC Name | 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane |
| SMILES | Cc1cc(C)n(-c2cccc(-n3nc(C)cc3C)n2)n1.Cl[Ru]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C15H17N5.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10-8-12(3)19(17-10)14-6-5-7-15(16-14)20-13(4)9-11(2)18-20;;;/h1-15H;5-9H,1-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | HDFTUCOICLPVEW-UHFFFAOYSA-L |
| XLogP | 7.51 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 701.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane?
The IUPAC name of 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane (CID 11614572) is 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane.
What is the SMILES notation for 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane?
The canonical SMILES for 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane is Cc1cc(C)n(-c2cccc(-n3nc(C)cc3C)n2)n1.Cl[Ru]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane?
The InChIKey is HDFTUCOICLPVEW-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.C15H17N5.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10-8-12(3)19(17-10)14-6-5-7-15(16-14)20-13(4)9-11(2)18-20;;;/h1-15H;5-9H,1-4H3;2*1H;/q;;;;+2/p-2.
What are the key properties of 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane?
2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane has a molecular weight of 701.60 g/mol, XLogP of 7.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(3,5-dimethylpyrazol-1-yl)pyridine;dichlororuthenium;triphenylphosphane is sourced from PubChem (CID 11614572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).