C31H31BrN7O6S+ — CID 11614603
3-[2-[5-(1,3-benzodioxol-5-yl)-3-(5-methoxybenzo[e][1,3]benzothiazol-2-yl)tetrazol-3-ium-2-yl]phenoxy]propyl-dimethylazanium;nitrous acid;bromide (PubChem CID 11614603) has the molecular formula C31H31BrN7O6S+ and a molecular weight of 709.60 g/mol. Its IUPAC name is 3-[2-[5-(1,3-benzodioxol-5-yl)-3-(5-methoxybenzo[e][1,3]benzothiazol-2-yl)tetrazol-3-ium-2-yl]phenoxy]propyl-dimethylazanium;nitrous acid;bromide.
| Compound Name | 3-[2-[5-(1,3-benzodioxol-5-yl)-3-(5-methoxybenzo[e][1,3]benzothiazol-2-yl)tetrazol-3-ium-2-yl]phenoxy]propyl-dimethylazanium;nitrous acid;bromide |
|---|---|
| PubChem CID | 11614603 |
| Molecular Formula | C31H31BrN7O6S+ |
| Molecular Weight | 709.60 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | 3-[2-[5-(1,3-benzodioxol-5-yl)-3-(5-methoxybenzo[e][1,3]benzothiazol-2-yl)tetrazol-3-ium-2-yl]phenoxy]propyl-dimethylazanium;nitrous acid;bromide |
| SMILES | COc1cc2sc(-[n+]3nc(-c4ccc5c(c4)OCO5)nn3-c3ccccc3OCCC[NH+](C)C)nc2c2ccccc12.O=NO.[Br-] |
| InChI | InChI=1S/C31H29N6O4S.BrH.HNO2/c1-35(2)15-8-16-39-24-12-7-6-11-23(24)36-33-30(20-13-14-25-27(17-20)41-19-40-25)34-37(36)31-32-29-22-10-5-4-9-21(22)26(38-3)18-28(29)42-31;;2-1-3/h4-7,9-14,17-18H,8,15-16,19H2,1-3H3;1H;(H,2,3)/q+1;; |
| InChIKey | DGOVJASFEHYIJP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|