C46H34O9 — CID 11614664
1-(2,7-dihydroxy-4-methoxyphenanthren-1-yl)-8-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol (PubChem CID 11614664) has the molecular formula C46H34O9 and a molecular weight of 730.77 g/mol. Its IUPAC name is 1-(2,7-dihydroxy-4-methoxyphenanthren-1-yl)-8-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol.
| Compound Name | 1-(2,7-dihydroxy-4-methoxyphenanthren-1-yl)-8-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
|---|---|
| PubChem CID | 11614664 |
| Molecular Formula | C46H34O9 |
| Molecular Weight | 730.77 g/mol |
| Exact Mass | 730.22 |
| IUPAC Name | 1-(2,7-dihydroxy-4-methoxyphenanthren-1-yl)-8-(2-hydroxy-4,7-dimethoxyphenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
| SMILES | COc1ccc2c(ccc3c(-c4c(O)ccc5c4ccc4c(-c6c(O)cc(OC)c7c6ccc6cc(O)ccc67)c(O)cc(OC)c45)c(O)cc(OC)c32)c1 |
| InChI | InChI=1S/C46H34O9/c1-52-25-8-12-27-23(18-25)6-10-30-41(27)38(54-3)19-34(49)44(30)43-29-13-14-32-42(28(29)15-16-33(43)48)39(55-4)21-36(51)46(32)45-31-9-5-22-17-24(47)7-11-26(22)40(31)37(53-2)20-35(45)50/h5-21,47-51H,1-4H3 |
| InChIKey | UVRKBDXVSOFXIN-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.77 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|