About pentanimidamide;hydrochloride
pentanimidamide;hydrochloride (PubChem CID 11615174) has the molecular formula C5H13ClN2
and a molecular weight of 136.63 g/mol. Its IUPAC name is pentanimidamide;hydrochloride.
Molecular Properties
| Compound Name | pentanimidamide;hydrochloride |
| PubChem CID | 11615174 |
| Molecular Formula | C5H13ClN2 |
| Molecular Weight | 136.63 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | pentanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N)CCCC |
| InChI | InChI=1S/C5H12N2.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H3,6,7);1H |
| InChIKey | FFHQVTXPIOPINO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.63 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze pentanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanimidamide;hydrochloride?
The IUPAC name of pentanimidamide;hydrochloride (CID 11615174) is pentanimidamide;hydrochloride.
What is the SMILES notation for pentanimidamide;hydrochloride?
The canonical SMILES for pentanimidamide;hydrochloride is Cl.[H]/N=C(/N)CCCC.
What is the InChIKey of pentanimidamide;hydrochloride?
The InChIKey is FFHQVTXPIOPINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H3,6,7);1H.
What are the key properties of pentanimidamide;hydrochloride?
pentanimidamide;hydrochloride has a molecular weight of 136.63 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanimidamide;hydrochloride is sourced from PubChem (CID 11615174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).