About (5-methyl-1,3,4-thiadiazol-2-yl)methanamine
(5-methyl-1,3,4-thiadiazol-2-yl)methanamine (PubChem CID 11615232) has the molecular formula C4H7N3S
and a molecular weight of 129.19 g/mol. Its IUPAC name is (5-methyl-1,3,4-thiadiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-methyl-1,3,4-thiadiazol-2-yl)methanamine |
| PubChem CID | 11615232 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | (5-methyl-1,3,4-thiadiazol-2-yl)methanamine |
| SMILES | Cc1nnc(CN)s1 |
| InChI | InChI=1S/C4H7N3S/c1-3-6-7-4(2-5)8-3/h2,5H2,1H3 |
| InChIKey | BPPLZEYBPSFHTO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,3,4-thiadiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)methanamine?
The IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)methanamine (CID 11615232) is (5-methyl-1,3,4-thiadiazol-2-yl)methanamine.
What is the SMILES notation for (5-methyl-1,3,4-thiadiazol-2-yl)methanamine?
The canonical SMILES for (5-methyl-1,3,4-thiadiazol-2-yl)methanamine is Cc1nnc(CN)s1.
What is the InChIKey of (5-methyl-1,3,4-thiadiazol-2-yl)methanamine?
The InChIKey is BPPLZEYBPSFHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S/c1-3-6-7-4(2-5)8-3/h2,5H2,1H3.
What are the key properties of (5-methyl-1,3,4-thiadiazol-2-yl)methanamine?
(5-methyl-1,3,4-thiadiazol-2-yl)methanamine has a molecular weight of 129.19 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-thiadiazol-2-yl)methanamine is sourced from PubChem (CID 11615232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).