C12H19NO — CID 11615335
(2E,5R)-4-hydroxy-5,9-dimethyldeca-2,8-dienenitrile (PubChem CID 11615335) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,5R)-4-hydroxy-5,9-dimethyldeca-2,8-dienenitrile.
| Compound Name | (2E,5R)-4-hydroxy-5,9-dimethyldeca-2,8-dienenitrile |
|---|---|
| PubChem CID | 11615335 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,5R)-4-hydroxy-5,9-dimethyldeca-2,8-dienenitrile |
| SMILES | CC(C)=CCC[C@@H](C)C(O)/C=C/C#N |
| InChI | InChI=1S/C12H19NO/c1-10(2)6-4-7-11(3)12(14)8-5-9-13/h5-6,8,11-12,14H,4,7H2,1-3H3/b8-5+/t11-,12?/m1/s1 |
| InChIKey | LZXCNUBCJOWDAV-JNGSMBTOSA-N |
| XLogP | 2.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|