C8H8N2O3S — CID 11615432
4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 11615432) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 11615432 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 4-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CN1C(=O)NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C8H8N2O3S/c1-10-6-4-2-3-5-7(6)14(12,13)9-8(10)11/h2-5H,1H3,(H,9,11) |
| InChIKey | RQCMUVKZNMGOOY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |