C9H17O5P — CID 11615604
diethyl [(3E)-4-methoxybuta-1,3-dien-2-yl] phosphate (PubChem CID 11615604) has the molecular formula C9H17O5P and a molecular weight of 236.20 g/mol. Its IUPAC name is diethyl [(3E)-4-methoxybuta-1,3-dien-2-yl] phosphate.
| Compound Name | diethyl [(3E)-4-methoxybuta-1,3-dien-2-yl] phosphate |
|---|---|
| PubChem CID | 11615604 |
| Molecular Formula | C9H17O5P |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | diethyl [(3E)-4-methoxybuta-1,3-dien-2-yl] phosphate |
| SMILES | C=C(/C=C/OC)OP(=O)(OCC)OCC |
| InChI | InChI=1S/C9H17O5P/c1-5-12-15(10,13-6-2)14-9(3)7-8-11-4/h7-8H,3,5-6H2,1-2,4H3/b8-7+ |
| InChIKey | BGGWVVBVOSWWBI-BQYQJAHWSA-N |
| XLogP | 2.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|