About (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one
(3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one (PubChem CID 11615836) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one |
| PubChem CID | 11615836 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@]2(CCC=C[C@H]2CCO)c2ccccc21 |
| InChI | InChI=1S/C16H19NO2/c1-17-14-8-3-2-7-13(14)16(15(17)19)10-5-4-6-12(16)9-11-18/h2-4,6-8,12,18H,5,9-11H2,1H3/t12-,16-/m0/s1 |
| InChIKey | YWCSBEWLJKBGNY-LRDDRELGSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one?
The IUPAC name of (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one (CID 11615836) is (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one.
What is the SMILES notation for (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one?
The canonical SMILES for (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one is CN1C(=O)[C@]2(CCC=C[C@H]2CCO)c2ccccc21.
What is the InChIKey of (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one?
The InChIKey is YWCSBEWLJKBGNY-LRDDRELGSA-N. The full InChI is InChI=1S/C16H19NO2/c1-17-14-8-3-2-7-13(14)16(15(17)19)10-5-4-6-12(16)9-11-18/h2-4,6-8,12,18H,5,9-11H2,1H3/t12-,16-/m0/s1.
What are the key properties of (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one?
(3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one has a molecular weight of 257.33 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-(2-hydroxyethyl)-1'-methylspiro[cyclohexene-4,3'-indole]-2'-one is sourced from PubChem (CID 11615836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).