About (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one
(5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one (PubChem CID 11615854) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one.
Molecular Properties
| Compound Name | (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one |
| PubChem CID | 11615854 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one |
| SMILES | CCCCC1=C(C)/C(=C/c2[nH]c(C)cc2C)NC1=O |
| InChI | InChI=1S/C16H22N2O/c1-5-6-7-13-12(4)15(18-16(13)19)9-14-10(2)8-11(3)17-14/h8-9,17H,5-7H2,1-4H3,(H,18,19)/b15-9- |
| InChIKey | UAQAWQJDWNPJDR-DHDCSXOGSA-N |
| XLogP | 3.61 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one?
The IUPAC name of (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one (CID 11615854) is (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one.
What is the SMILES notation for (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one?
The canonical SMILES for (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one is CCCCC1=C(C)/C(=C/c2[nH]c(C)cc2C)NC1=O.
What is the InChIKey of (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one?
The InChIKey is UAQAWQJDWNPJDR-DHDCSXOGSA-N. The full InChI is InChI=1S/C16H22N2O/c1-5-6-7-13-12(4)15(18-16(13)19)9-14-10(2)8-11(3)17-14/h8-9,17H,5-7H2,1-4H3,(H,18,19)/b15-9-.
What are the key properties of (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one?
(5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one has a molecular weight of 258.36 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3-butyl-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methylpyrrol-2-one is sourced from PubChem (CID 11615854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).