C12H14N4O3 — CID 11615884
(1S,2R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol (PubChem CID 11615884) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (1S,2R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 11615884 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1S,2R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C=C(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H14N4O3/c13-11-7-1-2-16(12(7)15-5-14-11)8-3-6(4-17)9(18)10(8)19/h1-3,5,8-10,17-19H,4H2,(H2,13,14,15)/t8-,9-,10+/m1/s1 |
| InChIKey | LNNHUAXCDFXQNM-BBBLOLIVSA-N |
| XLogP | -0.79 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|