C13H15Cl2NO — CID 11616021
6,8-dichloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole (PubChem CID 11616021) has the molecular formula C13H15Cl2NO and a molecular weight of 272.18 g/mol. Its IUPAC name is 6,8-dichloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole.
| Compound Name | 6,8-dichloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 11616021 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 6,8-dichloro-7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
| SMILES | COc1c(Cl)cc2c(c1Cl)C1CNCC1C2C |
| InChI | InChI=1S/C13H15Cl2NO/c1-6-7-3-10(14)13(17-2)12(15)11(7)9-5-16-4-8(6)9/h3,6,8-9,16H,4-5H2,1-2H3 |
| InChIKey | QZEXFZJNWUVTRO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |