C13H12F3NO3 — CID 11616218
(4S)-4-benzyl-3-(3,3,3-trifluoropropanoyl)-1,3-oxazolidin-2-one (PubChem CID 11616218) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(3,3,3-trifluoropropanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(3,3,3-trifluoropropanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11616218 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (4S)-4-benzyl-3-(3,3,3-trifluoropropanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CC(F)(F)F)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)7-11(18)17-10(8-20-12(17)19)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | KFIWIDUWRJLVPB-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |