About N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide
N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide (PubChem CID 11616233) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide.
Molecular Properties
| Compound Name | N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide |
| PubChem CID | 11616233 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide |
| SMILES | Cc1oc(CCCCCC(=O)NO)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-12-16(13-8-4-2-5-9-13)17-15(21-12)11-7-3-6-10-14(19)18-20/h2,4-5,8-9,20H,3,6-7,10-11H2,1H3,(H,18,19) |
| InChIKey | KQNSYUZKBWYADR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide?
The IUPAC name of N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide (CID 11616233) is N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide.
What is the SMILES notation for N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide?
The canonical SMILES for N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide is Cc1oc(CCCCCC(=O)NO)nc1-c1ccccc1.
What is the InChIKey of N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide?
The InChIKey is KQNSYUZKBWYADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-12-16(13-8-4-2-5-9-13)17-15(21-12)11-7-3-6-10-14(19)18-20/h2,4-5,8-9,20H,3,6-7,10-11H2,1H3,(H,18,19).
What are the key properties of N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide?
N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide has a molecular weight of 288.35 g/mol, XLogP of 3.26, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-6-(5-methyl-4-phenyl-1,3-oxazol-2-yl)hexanamide is sourced from PubChem (CID 11616233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).