C11H18N+ — CID 11616618
(7E)-7-ethylidene-1-methyl-2,3,3a,4,5,6-hexahydroindol-1-ium (PubChem CID 11616618) has the molecular formula C11H18N+ and a molecular weight of 164.27 g/mol. Its IUPAC name is (7E)-7-ethylidene-1-methyl-2,3,3a,4,5,6-hexahydroindol-1-ium.
| Compound Name | (7E)-7-ethylidene-1-methyl-2,3,3a,4,5,6-hexahydroindol-1-ium |
|---|---|
| PubChem CID | 11616618 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | (7E)-7-ethylidene-1-methyl-2,3,3a,4,5,6-hexahydroindol-1-ium |
| SMILES | C/C=C1\CCCC2CC[N+](C)=C12 |
| InChI | InChI=1S/C11H18N/c1-3-9-5-4-6-10-7-8-12(2)11(9)10/h3,10H,4-8H2,1-2H3/q+1/b9-3+ |
| InChIKey | MRLOPVNEHJCDGC-YCRREMRBSA-N |
| XLogP | 2.22 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|