About (2S,3R)-2-aminoicosane-1,3-diol
(2S,3R)-2-aminoicosane-1,3-diol (PubChem CID 11616885) has the molecular formula C20H43NO2
and a molecular weight of 329.57 g/mol. Its IUPAC name is (2S,3R)-2-aminoicosane-1,3-diol.
Molecular Properties
| Compound Name | (2S,3R)-2-aminoicosane-1,3-diol |
| PubChem CID | 11616885 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | (2S,3R)-2-aminoicosane-1,3-diol |
| SMILES | CCCCCCCCCCCCCCCCC[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C20H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h19-20,22-23H,2-18,21H2,1H3/t19-,20+/m0/s1 |
| InChIKey | UFMHYBVQZSPWSS-VQTJNVASSA-N |
| XLogP | 4.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-aminoicosane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-aminoicosane-1,3-diol?
The IUPAC name of (2S,3R)-2-aminoicosane-1,3-diol (CID 11616885) is (2S,3R)-2-aminoicosane-1,3-diol.
What is the SMILES notation for (2S,3R)-2-aminoicosane-1,3-diol?
The canonical SMILES for (2S,3R)-2-aminoicosane-1,3-diol is CCCCCCCCCCCCCCCCC[C@@H](O)[C@@H](N)CO.
What is the InChIKey of (2S,3R)-2-aminoicosane-1,3-diol?
The InChIKey is UFMHYBVQZSPWSS-VQTJNVASSA-N. The full InChI is InChI=1S/C20H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h19-20,22-23H,2-18,21H2,1H3/t19-,20+/m0/s1.
What are the key properties of (2S,3R)-2-aminoicosane-1,3-diol?
(2S,3R)-2-aminoicosane-1,3-diol has a molecular weight of 329.57 g/mol, XLogP of 4.93, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-aminoicosane-1,3-diol is sourced from PubChem (CID 11616885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).