C18H20ClFN2O — CID 11616967
(3R)-3-amino-N-[1-(4-chlorophenyl)ethyl]-4-(2-fluorophenyl)butanamide (PubChem CID 11616967) has the molecular formula C18H20ClFN2O and a molecular weight of 334.82 g/mol. Its IUPAC name is (3R)-3-amino-N-[1-(4-chlorophenyl)ethyl]-4-(2-fluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[1-(4-chlorophenyl)ethyl]-4-(2-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 11616967 |
| Molecular Formula | C18H20ClFN2O |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (3R)-3-amino-N-[1-(4-chlorophenyl)ethyl]-4-(2-fluorophenyl)butanamide |
| SMILES | CC(NC(=O)C[C@H](N)Cc1ccccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClFN2O/c1-12(13-6-8-15(19)9-7-13)22-18(23)11-16(21)10-14-4-2-3-5-17(14)20/h2-9,12,16H,10-11,21H2,1H3,(H,22,23)/t12?,16-/m1/s1 |
| InChIKey | VDLMVMWEWXYRKN-PVQCJRHBSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |