C16H9F5N2O — CID 11617048
5-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 11617048) has the molecular formula C16H9F5N2O and a molecular weight of 340.25 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 11617048 |
| Molecular Formula | C16H9F5N2O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 5-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(C(c2ccc[nH]2)c2c(F)c(F)c(F)c(F)c2F)[nH]1 |
| InChI | InChI=1S/C16H9F5N2O/c17-12-11(13(18)15(20)16(21)14(12)19)10(8-2-1-5-22-8)9-4-3-7(6-24)23-9/h1-6,10,22-23H |
| InChIKey | MOUWEYWJIUQOOE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|