About ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate
ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate (PubChem CID 11617180) has the molecular formula C19H23ClN2O2
and a molecular weight of 346.86 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate |
| PubChem CID | 11617180 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C)C[C@H]1c1cc2c(C)ccc(C)c2nc1Cl |
| InChI | InChI=1S/C19H23ClN2O2/c1-5-24-19(23)16-10-22(4)9-15(16)14-8-13-11(2)6-7-12(3)17(13)21-18(14)20/h6-8,15-16H,5,9-10H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | KJJZUWMAJHJKFL-JKSUJKDBSA-N |
| XLogP | 3.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The IUPAC name of ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate (CID 11617180) is ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The canonical SMILES for ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate is CCOC(=O)[C@@H]1CN(C)C[C@H]1c1cc2c(C)ccc(C)c2nc1Cl.
What is the InChIKey of ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
The InChIKey is KJJZUWMAJHJKFL-JKSUJKDBSA-N. The full InChI is InChI=1S/C19H23ClN2O2/c1-5-24-19(23)16-10-22(4)9-15(16)14-8-13-11(2)6-7-12(3)17(13)21-18(14)20/h6-8,15-16H,5,9-10H2,1-4H3/t15-,16+/m0/s1.
What are the key properties of ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate?
ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate has a molecular weight of 346.86 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S,4R)-4-(2-chloro-5,8-dimethylquinolin-3-yl)-1-methylpyrrolidine-3-carboxylate is sourced from PubChem (CID 11617180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).