C21H23NO2Si — CID 11617227
(4S,5R)-4,5-diphenyl-3-(3-trimethylsilylprop-2-ynyl)-1,3-oxazolidin-2-one (PubChem CID 11617227) has the molecular formula C21H23NO2Si and a molecular weight of 349.51 g/mol. Its IUPAC name is (4S,5R)-4,5-diphenyl-3-(3-trimethylsilylprop-2-ynyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4,5-diphenyl-3-(3-trimethylsilylprop-2-ynyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11617227 |
| Molecular Formula | C21H23NO2Si |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4S,5R)-4,5-diphenyl-3-(3-trimethylsilylprop-2-ynyl)-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C#CCN1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO2Si/c1-25(2,3)16-10-15-22-19(17-11-6-4-7-12-17)20(24-21(22)23)18-13-8-5-9-14-18/h4-9,11-14,19-20H,15H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | XPAJYWIJFOYXMM-VQTJNVASSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|