C15H9Cl4N3 — CID 11617680
3,5-bis(2,3-dichlorophenyl)-4-methyl-1,2,4-triazole (PubChem CID 11617680) has the molecular formula C15H9Cl4N3 and a molecular weight of 373.07 g/mol. Its IUPAC name is 3,5-bis(2,3-dichlorophenyl)-4-methyl-1,2,4-triazole.
| Compound Name | 3,5-bis(2,3-dichlorophenyl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 11617680 |
| Molecular Formula | C15H9Cl4N3 |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 3,5-bis(2,3-dichlorophenyl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(-c2cccc(Cl)c2Cl)nnc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H9Cl4N3/c1-22-14(8-4-2-6-10(16)12(8)18)20-21-15(22)9-5-3-7-11(17)13(9)19/h2-7H,1H3 |
| InChIKey | HNZNQYMAJIIXRK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |