C19H21F2N5O — CID 11617693
1-[(4-aminophenyl)methyl-methylamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 11617693) has the molecular formula C19H21F2N5O and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl-methylamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[(4-aminophenyl)methyl-methylamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 11617693 |
| Molecular Formula | C19H21F2N5O |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[(4-aminophenyl)methyl-methylamino]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CN(Cc1ccc(N)cc1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H21F2N5O/c1-25(9-14-2-5-16(22)6-3-14)10-19(27,11-26-13-23-12-24-26)17-7-4-15(20)8-18(17)21/h2-8,12-13,27H,9-11,22H2,1H3 |
| InChIKey | VHJQQKYALMQTIA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|