C24H39NO2 — CID 11617702
(7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol (PubChem CID 11617702) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol.
| Compound Name | (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol |
|---|---|
| PubChem CID | 11617702 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ol |
| SMILES | CC(C)c1cc(C(C)C)c([C@H](C)O[C@@H]2CCN3CCC(O)[C@H]23)c(C(C)C)c1 |
| InChI | InChI=1S/C24H39NO2/c1-14(2)18-12-19(15(3)4)23(20(13-18)16(5)6)17(7)27-22-9-11-25-10-8-21(26)24(22)25/h12-17,21-22,24,26H,8-11H2,1-7H3/t17-,21?,22+,24+/m0/s1 |
| InChIKey | GPTDJBLRZVBEHT-CPEVCAPKSA-N |
| XLogP | 5.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |