C19H30NO5P — CID 11617897
1-[4-[2-(5-amino-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]phenyl]octan-1-one (PubChem CID 11617897) has the molecular formula C19H30NO5P and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-[4-[2-(5-amino-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]phenyl]octan-1-one.
| Compound Name | 1-[4-[2-(5-amino-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]phenyl]octan-1-one |
|---|---|
| PubChem CID | 11617897 |
| Molecular Formula | C19H30NO5P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[4-[2-(5-amino-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl)ethyl]phenyl]octan-1-one |
| SMILES | CCCCCCCC(=O)c1ccc(CCC2(N)COP(=O)(O)OC2)cc1 |
| InChI | InChI=1S/C19H30NO5P/c1-2-3-4-5-6-7-18(21)17-10-8-16(9-11-17)12-13-19(20)14-24-26(22,23)25-15-19/h8-11H,2-7,12-15,20H2,1H3,(H,22,23) |
| InChIKey | UIGDIYHCWVMQSA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|