C15H14F6N2OS — CID 11617908
2-[4-[ethyl(1,3-thiazol-4-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11617908) has the molecular formula C15H14F6N2OS and a molecular weight of 384.35 g/mol. Its IUPAC name is 2-[4-[ethyl(1,3-thiazol-4-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[ethyl(1,3-thiazol-4-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11617908 |
| Molecular Formula | C15H14F6N2OS |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[4-[ethyl(1,3-thiazol-4-ylmethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(Cc1cscn1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F6N2OS/c1-2-23(7-11-8-25-9-22-11)12-5-3-10(4-6-12)13(24,14(16,17)18)15(19,20)21/h3-6,8-9,24H,2,7H2,1H3 |
| InChIKey | DBCGQWBJSYJXSD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|