About 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate
3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate (PubChem CID 11618071) has the molecular formula C22H21N3O4
and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate.
Molecular Properties
| Compound Name | 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate |
| PubChem CID | 11618071 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate |
| SMILES | CC(C)CCOC(=O)Nc1cccc2nc(-c3ccco3)c(-c3ccco3)nc12 |
| InChI | InChI=1S/C22H21N3O4/c1-14(2)10-13-29-22(26)24-16-7-3-6-15-19(16)25-21(18-9-5-12-28-18)20(23-15)17-8-4-11-27-17/h3-9,11-12,14H,10,13H2,1-2H3,(H,24,26) |
| InChIKey | IKFUGJPOCDUYLD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate?
The IUPAC name of 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate (CID 11618071) is 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate.
What is the SMILES notation for 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate?
The canonical SMILES for 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate is CC(C)CCOC(=O)Nc1cccc2nc(-c3ccco3)c(-c3ccco3)nc12.
What is the InChIKey of 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate?
The InChIKey is IKFUGJPOCDUYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O4/c1-14(2)10-13-29-22(26)24-16-7-3-6-15-19(16)25-21(18-9-5-12-28-18)20(23-15)17-8-4-11-27-17/h3-9,11-12,14H,10,13H2,1-2H3,(H,24,26).
What are the key properties of 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate?
3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate has a molecular weight of 391.43 g/mol, XLogP of 5.74, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl N-[2,3-bis(furan-2-yl)quinoxalin-5-yl]carbamate is sourced from PubChem (CID 11618071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).