C16H17Cl3N2OS — CID 11618082
cis-(1R,2R)-N-(cyanomethyl)-2-[(2,4,5-trichlorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide (PubChem CID 11618082) has the molecular formula C16H17Cl3N2OS and a molecular weight of 391.75 g/mol. Its IUPAC name is cis-(1R,2R)-N-(cyanomethyl)-2-[(2,4,5-trichlorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(cyanomethyl)-2-[(2,4,5-trichlorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11618082 |
| Molecular Formula | C16H17Cl3N2OS |
| Molecular Weight | 391.75 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | cis-(1R,2R)-N-(cyanomethyl)-2-[(2,4,5-trichlorophenyl)sulfanylmethyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@H]1CSc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl3N2OS/c17-12-7-14(19)15(8-13(12)18)23-9-10-3-1-2-4-11(10)16(22)21-6-5-20/h7-8,10-11H,1-4,6,9H2,(H,21,22)/t10-,11+/m0/s1 |
| InChIKey | LGZLUTBIOYIXRU-WDEREUQCSA-N |
| XLogP | 5.19 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|