C21H25ClN4O2 — CID 11618264
[4-[2-chloro-6-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 11618264) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is [4-[2-chloro-6-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-chloro-6-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 11618264 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [4-[2-chloro-6-(4-methylpiperazin-1-yl)-4-pyridinyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | CN1CCN(c2cc(-c3ccc(C(=O)N4CCOCC4)cc3)cc(Cl)n2)CC1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-24-6-8-25(9-7-24)20-15-18(14-19(22)23-20)16-2-4-17(5-3-16)21(27)26-10-12-28-13-11-26/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | CJSMETYPQCURJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|