C19H22N4O4S — CID 11618292
N-(diaminomethylidene)-8-(dimethylamino)-1,10-dimethyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11618292) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-(dimethylamino)-1,10-dimethyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-(dimethylamino)-1,10-dimethyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11618292 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(diaminomethylidene)-8-(dimethylamino)-1,10-dimethyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(N(C)C)cc2c1Oc1c(C)cc(C(=O)N=C(N)N)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C19H22N4O4S/c1-10-5-12(18(24)22-19(20)21)8-15-17(10)27-16-11(2)6-14(23(3)4)7-13(16)9-28(15,25)26/h5-8H,9H2,1-4H3,(H4,20,21,22,24) |
| InChIKey | OFEVQTQZECVXPQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|