About methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate
methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate (PubChem CID 11618315) has the molecular formula C28H21NO2
and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate |
| PubChem CID | 11618315 |
| Molecular Formula | C28H21NO2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3cccc(/C(=C/c4ccccc4)c4ccccc4)c3c2c1 |
| InChI | InChI=1S/C28H21NO2/c1-31-28(30)21-15-16-25-24(18-21)27-22(13-8-14-26(27)29-25)23(20-11-6-3-7-12-20)17-19-9-4-2-5-10-19/h2-18,29H,1H3/b23-17+ |
| InChIKey | USEBAHKPIGXXDM-HAVVHWLPSA-N |
| XLogP | 6.70 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate?
The IUPAC name of methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate (CID 11618315) is methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate.
What is the SMILES notation for methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate?
The canonical SMILES for methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate is COC(=O)c1ccc2[nH]c3cccc(/C(=C/c4ccccc4)c4ccccc4)c3c2c1.
What is the InChIKey of methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate?
The InChIKey is USEBAHKPIGXXDM-HAVVHWLPSA-N. The full InChI is InChI=1S/C28H21NO2/c1-31-28(30)21-15-16-25-24(18-21)27-22(13-8-14-26(27)29-25)23(20-11-6-3-7-12-20)17-19-9-4-2-5-10-19/h2-18,29H,1H3/b23-17+.
What are the key properties of methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate?
methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate has a molecular weight of 403.48 g/mol, XLogP of 6.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(E)-1,2-diphenylethenyl]-9H-carbazole-3-carboxylate is sourced from PubChem (CID 11618315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).