C26H39NO3 — CID 11618501
methyl (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5,6,7,8-tetrahydro-3H-pyrrolizine-1-carboxylate (PubChem CID 11618501) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is methyl (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5,6,7,8-tetrahydro-3H-pyrrolizine-1-carboxylate.
| Compound Name | methyl (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5,6,7,8-tetrahydro-3H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 11618501 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | methyl (7R,8R)-7-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5,6,7,8-tetrahydro-3H-pyrrolizine-1-carboxylate |
| SMILES | COC(=O)C1=CCN2CC[C@@H](O[C@@H](C)c3c(C(C)C)cc(C(C)C)cc3C(C)C)[C@@H]12 |
| InChI | InChI=1S/C26H39NO3/c1-15(2)19-13-21(16(3)4)24(22(14-19)17(5)6)18(7)30-23-10-12-27-11-9-20(25(23)27)26(28)29-8/h9,13-18,23,25H,10-12H2,1-8H3/t18-,23+,25+/m0/s1 |
| InChIKey | KFWGWTXUFJWDDC-XYURVEJXSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |