C22H21F3N4O — CID 11618508
8-(3-prop-2-enylphenyl)-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine (PubChem CID 11618508) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 8-(3-prop-2-enylphenyl)-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine.
| Compound Name | 8-(3-prop-2-enylphenyl)-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 11618508 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 8-(3-prop-2-enylphenyl)-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
| SMILES | C=CCc1cccc(C2(c3ccc(OC(F)(F)F)cc3)N=C(N)N3CCCN=C32)c1 |
| InChI | InChI=1S/C22H21F3N4O/c1-2-5-15-6-3-7-17(14-15)21(19-27-12-4-13-29(19)20(26)28-21)16-8-10-18(11-9-16)30-22(23,24)25/h2-3,6-11,14H,1,4-5,12-13H2,(H2,26,28) |
| InChIKey | ZRKDUFNNAUAKMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|