C21H42O4Si2 — CID 11618523
trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one (PubChem CID 11618523) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one.
| Compound Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 11618523 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-hydroxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C1\[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si2/c1-20(2,3)26(7,8)24-13-11-12-17-18(23)14-16(22)15-19(17)25-27(9,10)21(4,5)6/h12,18-19,23H,11,13-15H2,1-10H3/b17-12+/t18-,19-/m1/s1 |
| InChIKey | IOFTZPBXBCJAPO-JBZHALFFSA-N |
| XLogP | 5.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|