About (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol (PubChem CID 11618562) has the molecular formula C18H13Cl2F3N2O2
and a molecular weight of 417.21 g/mol. Its IUPAC name is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol |
| PubChem CID | 11618562 |
| Molecular Formula | C18H13Cl2F3N2O2 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol |
| SMILES | OC/C=C/c1nn(Cc2ccc(Cl)cc2Cl)c2cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C18H13Cl2F3N2O2/c19-12-4-3-11(15(20)8-12)10-25-17-9-13(27-18(21,22)23)5-6-14(17)16(24-25)2-1-7-26/h1-6,8-9,26H,7,10H2/b2-1+ |
| InChIKey | ZMGUIEFNWLZTJQ-OWOJBTEDSA-N |
| XLogP | 5.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol?
The IUPAC name of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol (CID 11618562) is (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol.
What is the SMILES notation for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol?
The canonical SMILES for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol is OC/C=C/c1nn(Cc2ccc(Cl)cc2Cl)c2cc(OC(F)(F)F)ccc12.
What is the InChIKey of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol?
The InChIKey is ZMGUIEFNWLZTJQ-OWOJBTEDSA-N. The full InChI is InChI=1S/C18H13Cl2F3N2O2/c19-12-4-3-11(15(20)8-12)10-25-17-9-13(27-18(21,22)23)5-6-14(17)16(24-25)2-1-7-26/h1-6,8-9,26H,7,10H2/b2-1+.
What are the key properties of (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol?
(E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol has a molecular weight of 417.21 g/mol, XLogP of 5.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[1-[(2,4-dichlorophenyl)methyl]-6-(trifluoromethoxy)indazol-3-yl]prop-2-en-1-ol is sourced from PubChem (CID 11618562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).